Nalobrazepam (), also known as cinazepam or BD-798 and sold under the brand name Levana, is an atypical benzodiazepine derivative.
~3 min read
{{Drugbox | IUPAC_name = 4-{[7-Bromo-5-(2-chlorophenyl)-2-oxo-2,3-dihydro-1H-1,4-benzodiazepin-3-yl]oxy}-4-oxobutanoic acid | image = Cinazepam.svg | image_class = skin-invert-image | width = 266 | tradename = Levana | CAS_number = 172986-25-3 | UNII_Ref = | UNII = U4SS7UFXC7 | ATC_prefix = None | ATC_suffix = | PubChem = 629281 | DrugBank = | ChemSpiderID = 546502 | synonyms = Cinazepam; BD-798; BD798 | C=19 | H=14 | Br=1 | Cl=1 | N=2 | O=5 | smiles = c1ccc(c(c1)C2=NC(C(=O)Nc3c2cc(cc3)Br)OC(=O)CCC(=O)O)Cl | StdInChI = 1S/C19H14BrClN2O5/c20-10-5-6-14-12(9-10)17(11-3-1-2-4-13(11)21)23-19(18(27)22-14)28-16(26)8-7-15(24)25/h1-6,9,19H,7-8H2,(H,22,27)(H,24,25) | StdInChIKey = NQTRBZXDWMDXAQ-UHFFFAOYSA-N | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = }}
Nalobrazepam (), also known as cinazepam or BD-798 and sold under the brand name Levana, is an atypical benzodiazepine derivative.
Discovered by embedding cosine similarity (sentence-transformers MiniLM, 384-dim).