EDDS
Sign in to save'Ethylenediamine-N,N'-disuccinic acid (EDDS') is an aminopolycarboxylic acid. It is a colourless solid that is used as chelating agent that may offer a biodegradable alternative to EDTA, which is currently used on a large scale in numerous applications.
Wikidata facts
- Mass
- 292.090665
Show 2 more facts
- chemical formula
- C₁₀H₁₆N₂O₈
- canonical SMILES
- C(CNC(CC(=O)O)C(=O)O)NC(CC(=O)O)C(=O)O
Sources (2)
via Wikidata · CC0
~5 min read
Article
7 sectionsContents
- Structure and properties
- Synthesis
- From aspartic acid
- Coordination chemistry
- Uses
- External links
- References
{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 439643372 | ImageFile = 2,2'-(ethane-1,2-diylbis(azanediyl))disuccinic acid 200.svg | ImageClass = skin-invert-image | ImageFile_Ref = | ImageName = Skeletal formula of EDDS | IUPACName = Ethylenediamine-N,N′-disuccinic acid |Section1={{Chembox Identifiers | CASNo = 20846-91-7 | CASNo_Ref = | UNII_Ref = | UNII = 5WK2FGJ113 | PubChem = 123395 | PubChem1 = 11314994 | PubChem1_Comment = 2-[(2-{[(1S)-1-Carboxyethyl]amino}ethyl)amino] | PubChem2 = 10108362 | PubChem2_Comment = (2R)-2-[(2-{[(1R)-1-Carboxyethyl]amino}ethyl)amino] | PubChem3 = 497266 | PubChem3_Comment = (2S)-2-[(2-{[(1S)-1-Carboxyethyl]amino}ethyl)amino] | PubChem4 = 46218600 | PubChem4_Comment = (2S)-2-[(2-{[(1R)-1-Carboxyethyl]amino}ethyl)amino] | ChemSpiderID = 109992 | ChemSpiderID_Ref = | ChemSpiderID1 = 9489961 | ChemSpiderID1_Ref = | ChemSpiderID1_Comment = 2-[(2-{[(1S)-1-Carboxyethyl]amino}ethyl)amino] | ChemSpiderID2 = 8283888 | ChemSpiderID2_Ref = | ChemSpiderID2_Comment = (2R)-2-[(2-{[(1R)-1-Carboxyethyl]amino}ethyl)amino] | ChemSpiderID3 = 435376 | ChemSpiderID3_Ref = | ChemSpiderID3_Comment = (2S)-2-[(2-{[(1S)-1-Carboxyethyl]amino}ethyl)amino] | MeSHName = N,N'-ethylenediamine+disuccinic+acid | SMILES = O=C(O)CC(NCCNC(CC(=O)O)C(=O)O)C(=O)O | StdInChI = 1S/C10H16N2O8/c13-7(14)3-5(9(17)18)11-1-2-12-6(10(19)20)4-8(15)16/h5-6,11-12H,1-4H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20) | StdInChI_Ref = | StdInChIKey = VKZRWSNIWNFCIQ-UHFFFAOYSA-N | StdInChIKey_Ref = }} |Section2= |Section3= |Section4= }}
'Ethylenediamine-N,N'-disuccinic acid (EDDS') is an aminopolycarboxylic acid. It is a colourless solid that is used as chelating agent that may offer a biodegradable alternative to EDTA, which is currently used on a large scale in numerous applications.