Skip to content
EntityQ1439361· pop 6· linked from 93 articles

fosfluconazole

Sign in to save

Fosfluconazole () is a water-soluble phosphate prodrug of fluconazole — a triazole antifungal drug used in the treatment and prevention of superficial and systemic fungal infections.

In the Vinony graph

Vinony's link graph records 93 inbound references to fosfluconazole, and connects out to antifungal, medication and digital object identifier.

It is catalogued under topics including Chemical pages without DrugBank identifier, Drugboxes which contain changes to verified fields and Drugboxes which contain changes to watched fields.

Vinony links it to 6 Wikipedia language editions.

Wikidata facts

Mass
386.07
Show 2 more facts
chemical formula
C₁₃H₁₃F₂N₆O₄P
canonical SMILES
C1=CC(=C(C=C1F)F)C(CN2C=NC=N2)(CN3C=NC=N3)OP(=O)(O)O
Sources (2)

via Wikidata · CC0

~2 min read

Encyclopedic overview

1 sections
Contents
  • References

{{Infobox drug | Verifiedfields = changed | Watchedfields = changed | ChemSpiderID2 = | verifiedrevid = 447618215 | drug_name = | type = | IUPAC_name = {[2-(2,4-Difluorophenyl)-1,3-bis(1H-1,2,4-triazol-1-yl)propan-2-yl]oxy}phosphonic acid | image = Fosfluconazol.svg | image_class = skin-invert-image | width = | alt = | caption = | tradename = | Drugs.com = | MedlinePlus = | licence_EU = | licence_US = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = Rx-only | routes_of_administration = IV

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | CAS_number_Ref = | CAS_number = 194798-83-9 | ATC_prefix = none | ATC_suffix = | ATC_supplemental = | PubChem = 214356 | DrugBank_Ref = | DrugBank = | ChEMBL_Ref = | ChEMBL = 1908301 | ChemSpiderID_Ref = | ChemSpiderID = 185843 | UNII_Ref = | UNII = 3JIJ299EWH | synonyms = | C=13 | H=13 | F=2 | N=6 | O=4 | P=1 | SMILES = Fc1ccc(c(F)c1)C(OP(=O)(O)O)(Cn2ncnc2)Cn3ncnc3 | StdInChI_Ref = | StdInChI = 1S/C13H13F2N6O4P/c14-10-1-2-11(12(15)3-10)13(25-26(22,23)24,4-20-8-16-6-18-20)5-21-9-17-7-19-21/h1-3,6-9H,4-5H2,(H2,22,23,24) | StdInChIKey_Ref = | StdInChIKey = GHJWNRRCRIGGIO-UHFFFAOYSA-N }}

Excerpted from Wikipedia’s “fosfluconazole” article, available under the CC BY-SA 4.0 licence.

Available in 6 languages

via Wikidata sitelinks · CC0

Connections

Categories