ranbezolid
Sign in to saveRanbezolid (RBx7644) is an oxazolidinone antibacterial. It competitively inhibits monoamine oxidase-A (MAO-A).
Wikidata facts
- Subclass of
- chemical compound
- Mass
- 461.171062
Show 4 more facts
- chemical formula
- C₂₁H₂₄FN₅O₆
- canonical SMILES
- CC(=O)NCC1CN(C(=O)O1)C2=CC(=C(C=C2)N3CCN(CC3)CC4=CC=C(O4)[N+](=O)[O-])F
- isomeric SMILES
- CC(=O)NC[C@H]1CN(C(=O)O1)C2=CC(=C(C=C2)N3CCN(CC3)CC4=CC=C(O4)[N+](=O)[O-])F
- Commons category
- Ranbezolid
Sources (1)
via Wikidata · CC0
~2 min read
Encyclopedic overview
1 sectionsContents
- References
{{Drugbox | IUPAC_name = N-{[(5S)-3-(3-Fluoro-4-{4-[(5-nitro-2-furyl)methyl]-1-piperazinyl}phenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl}acetamide | image = Ranbezolid structure.svg | image_class = skin-invert-image | width = 290 | alt = | image2 = | width2 = | drug_name = | caption =
| tradename = | licence_EU = | licence_US = | DailyMedID = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | dependency_liability = | routes_of_administration =
Excerpted from Wikipedia’s “ranbezolid” article, available under the CC BY-SA 4.0 licence.