Skip to content
EntityQ5103225· pop 9· linked from 421 articles

chlorphenoxamine

Sign in to save

Chlorphenoxamine (Phenoxene) is an antihistamine and anticholinergic used as an antipruritic and antiparkinsonian agent. It is an analog of diphenhydramine.

~1 min read

Encyclopedic overview

1 sections
Contents
  • References

{{Drugbox |Verifiedfields = changed |Watchedfields = changed |verifiedrevid = 447811372 |IUPAC_name = {2-[1-(4-chlorophenyl)-1-phenylethoxy]ethyl}dimethylamine |image = Chlorphenoxamine.svg |image_class = skin-invert-image |Drugs.com = |routes_of_administration = Oral, topical |bioavailability = Well absorbed |metabolism = Likely liver |excretion = kidney |CAS_number_Ref = |CAS_number = 77-38-3 |CAS_supplemental = |ATC_prefix = D04 |ATC_suffix = AA34 |ATC_supplemental = |PubChem = 6475 |DrugBank_Ref = |DrugBank = DB09007 |ChemSpiderID_Ref = |ChemSpiderID = 6230 |ChEMBL_Ref = |ChEMBL = 2110774 |UNII_Ref = |UNII = 3UVD77BP8R |KEGG_Ref = |KEGG = D07198 |C=18 | H=22 | Cl=1 | N=1 | O=1 |smiles = Clc1ccc(cc1)C(OCCN(C)C)(c2ccccc2)C |StdInChI_Ref = |StdInChI = 1S/C18H22ClNO/c1-18(21-14-13-20(2)3,15-7-5-4-6-8-15)16-9-11-17(19)12-10-16/h4-12H,13-14H2,1-3H3 |StdInChIKey_Ref = |StdInChIKey = KKHPNPMTPORSQE-UHFFFAOYSA-N }}

Chlorphenoxamine (Phenoxene) is an antihistamine and anticholinergic used as an antipruritic and antiparkinsonian agent. It is an analog of diphenhydramine.

Excerpted from Wikipedia’s “chlorphenoxamine” article, available under the CC BY-SA 4.0 licence.